C18H22N6O4S — CID 168626689
ethyl 1-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenyl]piperidine-4-carboxylate (PubChem CID 168626689) has the molecular formula C18H22N6O4S and a molecular weight of 418.48 g/mol. Its IUPAC name is ethyl 1-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 168626689 |
| Molecular Formula | C18H22N6O4S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | ethyl 1-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc([N+](=O)[O-])cc2C=NNc2nc(N)cs2)CC1 |
| InChI | InChI=1S/C18H22N6O4S/c1-2-28-17(25)12-5-7-23(8-6-12)15-4-3-14(24(26)27)9-13(15)10-20-22-18-21-16(19)11-29-18/h3-4,9-12H,2,5-8,19H2,1H3,(H,21,22) |
| InChIKey | QGGMNFLNFBTLPI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 135.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|