C17H11ClFN5O4S — CID 168628301
[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenyl] 2-chloro-6-fluorobenzoate (PubChem CID 168628301) has the molecular formula C17H11ClFN5O4S and a molecular weight of 435.82 g/mol. Its IUPAC name is [2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenyl] 2-chloro-6-fluorobenzoate.
| Compound Name | [2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenyl] 2-chloro-6-fluorobenzoate |
|---|---|
| PubChem CID | 168628301 |
| Molecular Formula | C17H11ClFN5O4S |
| Molecular Weight | 435.82 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | [2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenyl] 2-chloro-6-fluorobenzoate |
| SMILES | Nc1csc(NN=Cc2cc([N+](=O)[O-])ccc2OC(=O)c2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C17H11ClFN5O4S/c18-11-2-1-3-12(19)15(11)16(25)28-13-5-4-10(24(26)27)6-9(13)7-21-23-17-22-14(20)8-29-17/h1-8H,20H2,(H,22,23) |
| InChIKey | RUXATMXFTLNSTF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|