C10H9N5O3S — CID 168625605
3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenol (PubChem CID 168625605) has the molecular formula C10H9N5O3S and a molecular weight of 279.28 g/mol. Its IUPAC name is 3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenol.
| Compound Name | 3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 168625605 |
| Molecular Formula | C10H9N5O3S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenol |
| SMILES | Nc1csc(NN=Cc2cc(O)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H9N5O3S/c11-9-5-19-10(13-9)14-12-4-6-3-7(16)1-2-8(6)15(17)18/h1-5,16H,11H2,(H,13,14) |
| InChIKey | WOFAXWAHKVAKEQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 126.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|