C14H15N5O5S — CID 168626304
4-[3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenoxy]butanoic acid (PubChem CID 168626304) has the molecular formula C14H15N5O5S and a molecular weight of 365.37 g/mol. Its IUPAC name is 4-[3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenoxy]butanoic acid.
| Compound Name | 4-[3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenoxy]butanoic acid |
|---|---|
| PubChem CID | 168626304 |
| Molecular Formula | C14H15N5O5S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 4-[3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-nitrophenoxy]butanoic acid |
| SMILES | Nc1csc(NN=Cc2cc(OCCCC(=O)O)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H15N5O5S/c15-12-8-25-14(17-12)18-16-7-9-6-10(3-4-11(9)19(22)23)24-5-1-2-13(20)21/h3-4,6-8H,1-2,5,15H2,(H,17,18)(H,20,21) |
| InChIKey | VWJKGIJTHRURLR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 152.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|