C14H13N7O3S — CID 168627613
2-N-[[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627613) has the molecular formula C14H13N7O3S and a molecular weight of 359.37 g/mol. Its IUPAC name is 2-N-[[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627613 |
| Molecular Formula | C14H13N7O3S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-N-[[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2cccc(OCn3ccc([N+](=O)[O-])n3)c2)n1 |
| InChI | InChI=1S/C14H13N7O3S/c15-12-8-25-14(17-12)18-16-7-10-2-1-3-11(6-10)24-9-20-5-4-13(19-20)21(22)23/h1-8H,9,15H2,(H,17,18) |
| InChIKey | FFSXAYZZZOCTAX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|