C20H16N6O3S — CID 168578346
N-[[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168578346) has the molecular formula C20H16N6O3S and a molecular weight of 420.45 g/mol. Its IUPAC name is N-[[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168578346 |
| Molecular Formula | C20H16N6O3S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N-[[3-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccn(COc2cccc(C=NNc3nc(-c4ccccc4)cs3)c2)n1 |
| InChI | InChI=1S/C20H16N6O3S/c27-26(28)19-9-10-25(24-19)14-29-17-8-4-5-15(11-17)12-21-23-20-22-18(13-30-20)16-6-2-1-3-7-16/h1-13H,14H2,(H,22,23) |
| InChIKey | SDGFYBVAUPFLQX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|