C22H15Cl2N3OS — CID 168577542
N-[[3-(3,5-dichlorophenoxy)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168577542) has the molecular formula C22H15Cl2N3OS and a molecular weight of 440.36 g/mol. Its IUPAC name is N-[[3-(3,5-dichlorophenoxy)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[[3-(3,5-dichlorophenoxy)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577542 |
| Molecular Formula | C22H15Cl2N3OS |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | N-[[3-(3,5-dichlorophenoxy)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Clc1cc(Cl)cc(Oc2cccc(C=NNc3nc(-c4ccccc4)cs3)c2)c1 |
| InChI | InChI=1S/C22H15Cl2N3OS/c23-17-10-18(24)12-20(11-17)28-19-8-4-5-15(9-19)13-25-27-22-26-21(14-29-22)16-6-2-1-3-7-16/h1-14H,(H,26,27) |
| InChIKey | LSHBYPOKQACSQO-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|