C24H18N4OS — CID 168576992
2-[[3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 168576992) has the molecular formula C24H18N4OS and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[[3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 168576992 |
| Molecular Formula | C24H18N4OS |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[[3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1cccc(C=NNc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C24H18N4OS/c25-14-20-10-4-5-11-21(20)16-29-22-12-6-7-18(13-22)15-26-28-24-27-23(17-30-24)19-8-2-1-3-9-19/h1-13,15,17H,16H2,(H,27,28) |
| InChIKey | BOXBNTYBKNQHHK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|