C22H19BrN6O3S — CID 118721943
4-(4-bromophenyl)-N-[(E)-[3-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 118721943) has the molecular formula C22H19BrN6O3S and a molecular weight of 527.40 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-[(E)-[3-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-bromophenyl)-N-[(E)-[3-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 118721943 |
| Molecular Formula | C22H19BrN6O3S |
| Molecular Weight | 527.40 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | 4-(4-bromophenyl)-N-[(E)-[3-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOc1cccc(/C=N/Nc2nc(-c3ccc(Br)cc3)cs2)c1 |
| InChI | InChI=1S/C22H19BrN6O3S/c1-15-24-13-21(29(30)31)28(15)9-10-32-19-4-2-3-16(11-19)12-25-27-22-26-20(14-33-22)17-5-7-18(23)8-6-17/h2-8,11-14H,9-10H2,1H3,(H,26,27)/b25-12+ |
| InChIKey | LTSZWLXXTSHDQH-BRJLIKDPSA-N |
| XLogP | 5.51 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|