C17H23N5O2S — CID 168627165
2-N-[[3-(3-morpholin-4-ylpropoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627165) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-N-[[3-(3-morpholin-4-ylpropoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[3-(3-morpholin-4-ylpropoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627165 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-N-[[3-(3-morpholin-4-ylpropoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2cccc(OCCCN3CCOCC3)c2)n1 |
| InChI | InChI=1S/C17H23N5O2S/c18-16-13-25-17(20-16)21-19-12-14-3-1-4-15(11-14)24-8-2-5-22-6-9-23-10-7-22/h1,3-4,11-13H,2,5-10,18H2,(H,20,21) |
| InChIKey | AAJWAIFPSPFOTF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|