C14H14N4O6S — CID 168573979
4-[4-nitro-3-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]butanoic acid (PubChem CID 168573979) has the molecular formula C14H14N4O6S and a molecular weight of 366.36 g/mol. Its IUPAC name is 4-[4-nitro-3-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-nitro-3-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 168573979 |
| Molecular Formula | C14H14N4O6S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 4-[4-nitro-3-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc([N+](=O)[O-])c(C=NN=C2NC(=O)CS2)c1 |
| InChI | InChI=1S/C14H14N4O6S/c19-12-8-25-14(16-12)17-15-7-9-6-10(3-4-11(9)18(22)23)24-5-1-2-13(20)21/h3-4,6-7H,1-2,5,8H2,(H,20,21)(H,16,17,19) |
| InChIKey | ZGZAJLSFZFKGPY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 143.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|