C17H10F3N5O6S — CID 168574677
2-[[4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168574677) has the molecular formula C17H10F3N5O6S and a molecular weight of 469.36 g/mol. Its IUPAC name is 2-[[4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168574677 |
| Molecular Formula | C17H10F3N5O6S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 2-[[4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2ccc(Oc3c([N+](=O)[O-])cc(C(F)(F)F)cc3[N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C17H10F3N5O6S/c18-17(19,20)10-5-12(24(27)28)15(13(6-10)25(29)30)31-11-3-1-9(2-4-11)7-21-23-16-22-14(26)8-32-16/h1-7H,8H2,(H,22,23,26) |
| InChIKey | PCMUYBLFQUICHF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 149.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|