C12H8F5N3O2S — CID 168575339
2-[[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168575339) has the molecular formula C12H8F5N3O2S and a molecular weight of 353.27 g/mol. Its IUPAC name is 2-[[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168575339 |
| Molecular Formula | C12H8F5N3O2S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-[[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2cc(F)c(OCC(F)(F)F)c(F)c2)N1 |
| InChI | InChI=1S/C12H8F5N3O2S/c13-7-1-6(3-18-20-11-19-9(21)4-23-11)2-8(14)10(7)22-5-12(15,16)17/h1-3H,4-5H2,(H,19,20,21) |
| InChIKey | XLGGZILDBQSCDB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|