C14H15N3O6S — CID 168576111
2-[2,6-dimethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 168576111) has the molecular formula C14H15N3O6S and a molecular weight of 353.36 g/mol. Its IUPAC name is 2-[2,6-dimethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dimethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 168576111 |
| Molecular Formula | C14H15N3O6S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-[2,6-dimethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1cc(C=NN=C2NC(=O)CS2)cc(OC)c1OCC(=O)O |
| InChI | InChI=1S/C14H15N3O6S/c1-21-9-3-8(5-15-17-14-16-11(18)7-24-14)4-10(22-2)13(9)23-6-12(19)20/h3-5H,6-7H2,1-2H3,(H,19,20)(H,16,17,18) |
| InChIKey | FIHJRSIQMJUOEF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|