C14H15IN4O4S — CID 168575493
2-[2-ethoxy-6-iodo-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetamide (PubChem CID 168575493) has the molecular formula C14H15IN4O4S and a molecular weight of 462.27 g/mol. Its IUPAC name is 2-[2-ethoxy-6-iodo-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-ethoxy-6-iodo-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 168575493 |
| Molecular Formula | C14H15IN4O4S |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 2-[2-ethoxy-6-iodo-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(C=NN=C2NC(=O)CS2)cc(I)c1OCC(N)=O |
| InChI | InChI=1S/C14H15IN4O4S/c1-2-22-10-4-8(3-9(15)13(10)23-6-11(16)20)5-17-19-14-18-12(21)7-24-14/h3-5H,2,6-7H2,1H3,(H2,16,20)(H,18,19,21) |
| InChIKey | KXRCEFSCXUDCRT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|