C17H15N3O4S2 — CID 168575824
[2-ethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 168575824) has the molecular formula C17H15N3O4S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is [2-ethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [2-ethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 168575824 |
| Molecular Formula | C17H15N3O4S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [2-ethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | CCOc1cc(C=NN=C2NC(=O)CS2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C17H15N3O4S2/c1-2-23-13-8-11(9-18-20-17-19-15(21)10-26-17)5-6-12(13)24-16(22)14-4-3-7-25-14/h3-9H,2,10H2,1H3,(H,19,20,21) |
| InChIKey | TUEYSPSQQZUIMT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|