C15H16IN3O5S — CID 168575510
ethyl 2-[2-iodo-6-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 168575510) has the molecular formula C15H16IN3O5S and a molecular weight of 477.28 g/mol. Its IUPAC name is ethyl 2-[2-iodo-6-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-iodo-6-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 168575510 |
| Molecular Formula | C15H16IN3O5S |
| Molecular Weight | 477.28 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | ethyl 2-[2-iodo-6-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(C=NN=C2NC(=O)CS2)cc1OC |
| InChI | InChI=1S/C15H16IN3O5S/c1-3-23-13(21)7-24-14-10(16)4-9(5-11(14)22-2)6-17-19-15-18-12(20)8-25-15/h4-6H,3,7-8H2,1-2H3,(H,18,19,20) |
| InChIKey | QHXQGUWRDOZWLF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|