C20H19BrN4O5S — CID 168575554
2-[2-bromo-6-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 168575554) has the molecular formula C20H19BrN4O5S and a molecular weight of 507.37 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-bromo-6-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 168575554 |
| Molecular Formula | C20H19BrN4O5S |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)COc1c(Br)cc(C=NN=C2NC(=O)CS2)cc1OC |
| InChI | InChI=1S/C20H19BrN4O5S/c1-28-15-6-4-3-5-14(15)23-17(26)10-30-19-13(21)7-12(8-16(19)29-2)9-22-25-20-24-18(27)11-31-20/h3-9H,10-11H2,1-2H3,(H,23,26)(H,24,25,27) |
| InChIKey | ZPXMSUJZRNRKAJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|