C18H15BrClN3O3S — CID 135699741
(2E)-2-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135699741) has the molecular formula C18H15BrClN3O3S and a molecular weight of 468.76 g/mol. Its IUPAC name is (2E)-2-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135699741 |
| Molecular Formula | C18H15BrClN3O3S |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 466.97 |
| IUPAC Name | (2E)-2-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=N\N=C2/NC(=O)CS2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C18H15BrClN3O3S/c1-25-15-7-11(8-21-23-18-22-16(24)10-27-18)6-13(19)17(15)26-9-12-4-2-3-5-14(12)20/h2-8H,9-10H2,1H3,(H,22,23,24)/b21-8- |
| InChIKey | IMZSXVMJRGVMGL-WNFQYIGGSA-N |
| XLogP | 4.24 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|