C18H14BrCl2N3O3S — CID 168575546
2-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168575546) has the molecular formula C18H14BrCl2N3O3S and a molecular weight of 503.21 g/mol. Its IUPAC name is 2-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168575546 |
| Molecular Formula | C18H14BrCl2N3O3S |
| Molecular Weight | 503.21 g/mol |
| Exact Mass | 500.93 |
| IUPAC Name | 2-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C=NN=C2NC(=O)CS2)c(Br)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H14BrCl2N3O3S/c1-26-15-4-11(7-22-24-18-23-17(25)9-28-18)13(19)6-16(15)27-8-10-2-3-12(20)5-14(10)21/h2-7H,8-9H2,1H3,(H,23,24,25) |
| InChIKey | OAKCZRNVQATQOZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.21 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|