C15H16BrN3O5S — CID 168575415
methyl 2-[5-bromo-2-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]propanoate (PubChem CID 168575415) has the molecular formula C15H16BrN3O5S and a molecular weight of 430.28 g/mol. Its IUPAC name is methyl 2-[5-bromo-2-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]propanoate.
| Compound Name | methyl 2-[5-bromo-2-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 168575415 |
| Molecular Formula | C15H16BrN3O5S |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | methyl 2-[5-bromo-2-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1cc(Br)c(C=NN=C2NC(=O)CS2)cc1OC |
| InChI | InChI=1S/C15H16BrN3O5S/c1-8(14(21)23-3)24-12-5-10(16)9(4-11(12)22-2)6-17-19-15-18-13(20)7-25-15/h4-6,8H,7H2,1-3H3,(H,18,19,20) |
| InChIKey | ZUEMWHXFCCNCOZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|