C23H19BrFN3O4 — CID 4257932
N-[[3-bromo-4-[2-(2-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]benzamide (PubChem CID 4257932) has the molecular formula C23H19BrFN3O4 and a molecular weight of 500.32 g/mol. Its IUPAC name is N-[[3-bromo-4-[2-(2-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | N-[[3-bromo-4-[2-(2-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 4257932 |
| Molecular Formula | C23H19BrFN3O4 |
| Molecular Weight | 500.32 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | N-[[3-bromo-4-[2-(2-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccccc2)cc(Br)c1OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C23H19BrFN3O4/c1-31-20-12-15(13-26-28-23(30)16-7-3-2-4-8-16)11-17(24)22(20)32-14-21(29)27-19-10-6-5-9-18(19)25/h2-13H,14H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | HSVPCCISTXUVGX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|