C26H25BrFN3O4 — CID 4309242
N'-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide (PubChem CID 4309242) has the molecular formula C26H25BrFN3O4 and a molecular weight of 542.41 g/mol. Its IUPAC name is N'-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide.
| Compound Name | N'-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide |
|---|---|
| PubChem CID | 4309242 |
| Molecular Formula | C26H25BrFN3O4 |
| Molecular Weight | 542.41 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | N'-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide |
| SMILES | COc1cc(C=NNC(=O)CCC(=O)Nc2ccccc2F)cc(Br)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C26H25BrFN3O4/c1-17-7-9-18(10-8-17)16-35-26-20(27)13-19(14-23(26)34-2)15-29-31-25(33)12-11-24(32)30-22-6-4-3-5-21(22)28/h3-10,13-15H,11-12,16H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | MMPQVCNDFGOYHM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|