C21H19BrFN3O4 — CID 3978746
N'-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N-(2-fluorophenyl)butanediamide (PubChem CID 3978746) has the molecular formula C21H19BrFN3O4 and a molecular weight of 476.30 g/mol. Its IUPAC name is N'-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N-(2-fluorophenyl)butanediamide.
| Compound Name | N'-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N-(2-fluorophenyl)butanediamide |
|---|---|
| PubChem CID | 3978746 |
| Molecular Formula | C21H19BrFN3O4 |
| Molecular Weight | 476.30 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | N'-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N-(2-fluorophenyl)butanediamide |
| SMILES | C#CCOc1c(Br)cc(C=NNC(=O)CCC(=O)Nc2ccccc2F)cc1OC |
| InChI | InChI=1S/C21H19BrFN3O4/c1-3-10-30-21-15(22)11-14(12-18(21)29-2)13-24-26-20(28)9-8-19(27)25-17-7-5-4-6-16(17)23/h1,4-7,11-13H,8-10H2,2H3,(H,25,27)(H,26,28) |
| InChIKey | APJPZBBBIWBJFL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|