C21H19ClFN3O4 — CID 3972220
N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide (PubChem CID 3972220) has the molecular formula C21H19ClFN3O4 and a molecular weight of 431.85 g/mol. Its IUPAC name is N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide.
| Compound Name | N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide |
|---|---|
| PubChem CID | 3972220 |
| Molecular Formula | C21H19ClFN3O4 |
| Molecular Weight | 431.85 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide |
| SMILES | C#CCOc1c(Cl)cc(C=NNC(=O)C(C)C(=O)Nc2ccccc2F)cc1OC |
| InChI | InChI=1S/C21H19ClFN3O4/c1-4-9-30-19-15(22)10-14(11-18(19)29-3)12-24-26-21(28)13(2)20(27)25-17-8-6-5-7-16(17)23/h1,5-8,10-13H,9H2,2-3H3,(H,25,27)(H,26,28) |
| InChIKey | LCTKQHWIXMLYBN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.85 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|