C19H19ClFN3O4 — CID 135716563
N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide (PubChem CID 135716563) has the molecular formula C19H19ClFN3O4 and a molecular weight of 407.83 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide.
| Compound Name | N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide |
|---|---|
| PubChem CID | 135716563 |
| Molecular Formula | C19H19ClFN3O4 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(C)C(=O)Nc2ccccc2F)cc(Cl)c1O |
| InChI | InChI=1S/C19H19ClFN3O4/c1-3-28-16-9-12(8-13(20)17(16)25)10-22-24-19(27)11(2)18(26)23-15-7-5-4-6-14(15)21/h4-11,25H,3H2,1-2H3,(H,23,26)(H,24,27)/b22-10+ |
| InChIKey | QSIQWOQYNYQELK-LSHDLFTRSA-N |
| XLogP | 3.31 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|