C23H25FIN3O6 — CID 4541109
ethyl 2-[2-ethoxy-4-[[[3-(2-fluoroanilino)-2-methyl-3-oxopropanoyl]hydrazinylidene]methyl]-6-iodophenoxy]acetate (PubChem CID 4541109) has the molecular formula C23H25FIN3O6 and a molecular weight of 585.37 g/mol. Its IUPAC name is ethyl 2-[2-ethoxy-4-[[[3-(2-fluoroanilino)-2-methyl-3-oxopropanoyl]hydrazinylidene]methyl]-6-iodophenoxy]acetate.
| Compound Name | ethyl 2-[2-ethoxy-4-[[[3-(2-fluoroanilino)-2-methyl-3-oxopropanoyl]hydrazinylidene]methyl]-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 4541109 |
| Molecular Formula | C23H25FIN3O6 |
| Molecular Weight | 585.37 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | ethyl 2-[2-ethoxy-4-[[[3-(2-fluoroanilino)-2-methyl-3-oxopropanoyl]hydrazinylidene]methyl]-6-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(C=NNC(=O)C(C)C(=O)Nc2ccccc2F)cc1OCC |
| InChI | InChI=1S/C23H25FIN3O6/c1-4-32-19-11-15(10-17(25)21(19)34-13-20(29)33-5-2)12-26-28-23(31)14(3)22(30)27-18-9-7-6-8-16(18)24/h6-12,14H,4-5,13H2,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | FMOKMWAJHXWQET-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|