C28H36IN3O8 — CID 126010427
ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126010427) has the molecular formula C28H36IN3O8 and a molecular weight of 669.51 g/mol. Its IUPAC name is ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126010427 |
| Molecular Formula | C28H36IN3O8 |
| Molecular Weight | 669.51 g/mol |
| Exact Mass | 669.15 |
| IUPAC Name | ethyl 2-[2-ethoxy-6-iodo-4-[(Z)-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=N\NC(=O)[C@H](COCc2ccccc2)NC(=O)OC(C)(C)C)cc1OCC |
| InChI | InChI=1S/C28H36IN3O8/c1-6-37-23-14-20(13-21(29)25(23)39-18-24(33)38-7-2)15-30-32-26(34)22(31-27(35)40-28(3,4)5)17-36-16-19-11-9-8-10-12-19/h8-15,22H,6-7,16-18H2,1-5H3,(H,31,35)(H,32,34)/b30-15-/t22-/m0/s1 |
| InChIKey | VESVIOAUVYLYHL-IPVLUDNLSA-N |
| XLogP | 4.19 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|