C22H25I2N3O5 — CID 137127379
tert-butyl N-[(2S)-1-[(2Z)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate (PubChem CID 137127379) has the molecular formula C22H25I2N3O5 and a molecular weight of 665.27 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(2Z)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(2Z)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 137127379 |
| Molecular Formula | C22H25I2N3O5 |
| Molecular Weight | 665.27 g/mol |
| Exact Mass | 664.99 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(2Z)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COCc1ccccc1)C(=O)N/N=C\c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C22H25I2N3O5/c1-22(2,3)32-21(30)26-18(13-31-12-14-7-5-4-6-8-14)20(29)27-25-11-15-9-16(23)10-17(24)19(15)28/h4-11,18,28H,12-13H2,1-3H3,(H,26,30)(H,27,29)/b25-11-/t18-/m0/s1 |
| InChIKey | DLIZJXWQMCDGHX-FBFXLOEOSA-N |
| XLogP | 4.16 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|