C23H29N3O6 — CID 4259497
tert-butyl N-[1-[2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate (PubChem CID 4259497) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 4259497 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | tert-butyl N-[1-[2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate |
| SMILES | COc1cccc(C=NNC(=O)C(COCc2ccccc2)NC(=O)OC(C)(C)C)c1O |
| InChI | InChI=1S/C23H29N3O6/c1-23(2,3)32-22(29)25-18(15-31-14-16-9-6-5-7-10-16)21(28)26-24-13-17-11-8-12-19(30-4)20(17)27/h5-13,18,27H,14-15H2,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | ZAXJPWGZAZYNOB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|