C22H27IN2O4 — CID 126339869
tert-butyl N-[(2S)-1-(4-iodo-2-methylanilino)-1-oxo-3-phenylmethoxypropan-2-yl]carbamate (PubChem CID 126339869) has the molecular formula C22H27IN2O4 and a molecular weight of 510.37 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(4-iodo-2-methylanilino)-1-oxo-3-phenylmethoxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(4-iodo-2-methylanilino)-1-oxo-3-phenylmethoxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126339869 |
| Molecular Formula | C22H27IN2O4 |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | tert-butyl N-[(2S)-1-(4-iodo-2-methylanilino)-1-oxo-3-phenylmethoxypropan-2-yl]carbamate |
| SMILES | Cc1cc(I)ccc1NC(=O)[C@H](COCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27IN2O4/c1-15-12-17(23)10-11-18(15)24-20(26)19(25-21(27)29-22(2,3)4)14-28-13-16-8-6-5-7-9-16/h5-12,19H,13-14H2,1-4H3,(H,24,26)(H,25,27)/t19-/m0/s1 |
| InChIKey | ISEUOPLBNPPCOK-IBGZPJMESA-N |
| XLogP | 4.65 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|