C21H22BrIN2O5 — CID 98050703
ethyl 2-[4-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 98050703) has the molecular formula C21H22BrIN2O5 and a molecular weight of 589.22 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 98050703 |
| Molecular Formula | C21H22BrIN2O5 |
| Molecular Weight | 589.22 g/mol |
| Exact Mass | 587.98 |
| IUPAC Name | ethyl 2-[4-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=N\NC(=O)Cc2ccc(Br)cc2)cc1OCC |
| InChI | InChI=1S/C21H22BrIN2O5/c1-3-28-18-10-15(9-17(23)21(18)30-13-20(27)29-4-2)12-24-25-19(26)11-14-5-7-16(22)8-6-14/h5-10,12H,3-4,11,13H2,1-2H3,(H,25,26)/b24-12- |
| InChIKey | KUVLRXJPDADMMX-MSXFZWOLSA-N |
| XLogP | 4.09 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|