C16H18BrN3O5S — CID 168575566
ethyl 2-[2-bromo-6-ethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 168575566) has the molecular formula C16H18BrN3O5S and a molecular weight of 444.31 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-ethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-ethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 168575566 |
| Molecular Formula | C16H18BrN3O5S |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | ethyl 2-[2-bromo-6-ethoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(C=NN=C2NC(=O)CS2)cc1OCC |
| InChI | InChI=1S/C16H18BrN3O5S/c1-3-23-12-6-10(7-18-20-16-19-13(21)9-26-16)5-11(17)15(12)25-8-14(22)24-4-2/h5-7H,3-4,8-9H2,1-2H3,(H,19,20,21) |
| InChIKey | WIKMTAHOYSHJCG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|