C14H7F3N2O6 — CID 2779971
4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]benzaldehyde (PubChem CID 2779971) has the molecular formula C14H7F3N2O6 and a molecular weight of 356.21 g/mol. Its IUPAC name is 4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]benzaldehyde.
| Compound Name | 4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]benzaldehyde |
|---|---|
| PubChem CID | 2779971 |
| Molecular Formula | C14H7F3N2O6 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]benzaldehyde |
| SMILES | O=Cc1ccc(Oc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H7F3N2O6/c15-14(16,17)9-5-11(18(21)22)13(12(6-9)19(23)24)25-10-3-1-8(7-20)2-4-10/h1-7H |
| InChIKey | SLHLLGOTZBVLFL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|