C20H10F4O4 — CID 1380013
4-[2,3,5,6-tetrafluoro-4-(4-formylphenoxy)phenoxy]benzaldehyde (PubChem CID 1380013) has the molecular formula C20H10F4O4 and a molecular weight of 390.29 g/mol. Its IUPAC name is 4-[2,3,5,6-tetrafluoro-4-(4-formylphenoxy)phenoxy]benzaldehyde.
| Compound Name | 4-[2,3,5,6-tetrafluoro-4-(4-formylphenoxy)phenoxy]benzaldehyde |
|---|---|
| PubChem CID | 1380013 |
| Molecular Formula | C20H10F4O4 |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 4-[2,3,5,6-tetrafluoro-4-(4-formylphenoxy)phenoxy]benzaldehyde |
| SMILES | O=Cc1ccc(Oc2c(F)c(F)c(Oc3ccc(C=O)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H10F4O4/c21-15-17(23)20(28-14-7-3-12(10-26)4-8-14)18(24)16(22)19(15)27-13-5-1-11(9-25)2-6-13/h1-10H |
| InChIKey | OLSSPIZDUNVTIK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|