C12H4BrF5O — CID 29052620
1-(4-bromophenoxy)-2,3,4,5,6-pentafluorobenzene (PubChem CID 29052620) has the molecular formula C12H4BrF5O and a molecular weight of 339.06 g/mol. Its IUPAC name is 1-(4-bromophenoxy)-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(4-bromophenoxy)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 29052620 |
| Molecular Formula | C12H4BrF5O |
| Molecular Weight | 339.06 g/mol |
| Exact Mass | 337.94 |
| IUPAC Name | 1-(4-bromophenoxy)-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1c(F)c(F)c(Oc2ccc(Br)cc2)c(F)c1F |
| InChI | InChI=1S/C12H4BrF5O/c13-5-1-3-6(4-2-5)19-12-10(17)8(15)7(14)9(16)11(12)18/h1-4H |
| InChIKey | RTZZGAWCRUPERU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.06 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|