C14H9F2NO3 — CID 59730109
3,5-difluoro-4-(4-formylphenoxy)benzamide (PubChem CID 59730109) has the molecular formula C14H9F2NO3 and a molecular weight of 277.23 g/mol. Its IUPAC name is 3,5-difluoro-4-(4-formylphenoxy)benzamide.
| Compound Name | 3,5-difluoro-4-(4-formylphenoxy)benzamide |
|---|---|
| PubChem CID | 59730109 |
| Molecular Formula | C14H9F2NO3 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 3,5-difluoro-4-(4-formylphenoxy)benzamide |
| SMILES | NC(=O)c1cc(F)c(Oc2ccc(C=O)cc2)c(F)c1 |
| InChI | InChI=1S/C14H9F2NO3/c15-11-5-9(14(17)19)6-12(16)13(11)20-10-3-1-8(7-18)2-4-10/h1-7H,(H2,17,19) |
| InChIKey | RNXBSOXPXOMRIV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|