About 4-formylbenzamide;methanamine
4-formylbenzamide;methanamine (PubChem CID 144619239) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 4-formylbenzamide;methanamine.
Molecular Properties
| Compound Name | 4-formylbenzamide;methanamine |
| PubChem CID | 144619239 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 4-formylbenzamide;methanamine |
| SMILES | CN.NC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C8H7NO2.CH5N/c9-8(11)7-3-1-6(5-10)2-4-7;1-2/h1-5H,(H2,9,11);2H2,1H3 |
| InChIKey | ACYRQIMBXCDBRG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-formylbenzamide;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formylbenzamide;methanamine?
The IUPAC name of 4-formylbenzamide;methanamine (CID 144619239) is 4-formylbenzamide;methanamine.
What is the SMILES notation for 4-formylbenzamide;methanamine?
The canonical SMILES for 4-formylbenzamide;methanamine is CN.NC(=O)c1ccc(C=O)cc1.
What is the InChIKey of 4-formylbenzamide;methanamine?
The InChIKey is ACYRQIMBXCDBRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2.CH5N/c9-8(11)7-3-1-6(5-10)2-4-7;1-2/h1-5H,(H2,9,11);2H2,1H3.
What are the key properties of 4-formylbenzamide;methanamine?
4-formylbenzamide;methanamine has a molecular weight of 180.21 g/mol, XLogP of 0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formylbenzamide;methanamine is sourced from PubChem (CID 144619239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).