C10H12N4O — CID 89086080
2-[(Z)-1-(4-formylphenyl)ethylideneamino]guanidine (PubChem CID 89086080) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-[(Z)-1-(4-formylphenyl)ethylideneamino]guanidine.
| Compound Name | 2-[(Z)-1-(4-formylphenyl)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 89086080 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-[(Z)-1-(4-formylphenyl)ethylideneamino]guanidine |
| SMILES | C/C(=N/N=C(N)N)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C10H12N4O/c1-7(13-14-10(11)12)9-4-2-8(6-15)3-5-9/h2-6H,1H3,(H4,11,12,14)/b13-7- |
| InChIKey | SICRIVGTYNDMGY-QPEQYQDCSA-N |
| XLogP | 0.50 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|