C9H13N5O4 — CID 135534479
2-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]guanidine;nitric acid (PubChem CID 135534479) has the molecular formula C9H13N5O4 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]guanidine;nitric acid.
| Compound Name | 2-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]guanidine;nitric acid |
|---|---|
| PubChem CID | 135534479 |
| Molecular Formula | C9H13N5O4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]guanidine;nitric acid |
| SMILES | C/C(=N/N=C(N)N)c1ccc(O)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C9H12N4O.HNO3/c1-6(12-13-9(10)11)7-2-4-8(14)5-3-7;2-1(3)4/h2-5,14H,1H3,(H4,10,11,13);(H,2,3,4)/b12-6-; |
| InChIKey | YWCGOSOWUWBJHZ-DAMYXMBDSA-N |
| XLogP | 0.04 |
| TPSA | 160.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|