C15H17ClN4 — CID 54612215
2-[(E)-1-(4-phenylphenyl)ethylideneamino]guanidine;hydrochloride (PubChem CID 54612215) has the molecular formula C15H17ClN4 and a molecular weight of 288.78 g/mol. Its IUPAC name is 2-[(E)-1-(4-phenylphenyl)ethylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[(E)-1-(4-phenylphenyl)ethylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 54612215 |
| Molecular Formula | C15H17ClN4 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-[(E)-1-(4-phenylphenyl)ethylideneamino]guanidine;hydrochloride |
| SMILES | C/C(=N\N=C(N)N)c1ccc(-c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C15H16N4.ClH/c1-11(18-19-15(16)17)12-7-9-14(10-8-12)13-5-3-2-4-6-13;/h2-10H,1H3,(H4,16,17,19);1H/b18-11+; |
| InChIKey | NSQJWCKHXKXELA-NWBUNABESA-N |
| XLogP | 2.77 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|