C11H19Cl2N9 — CID 24832561
1-carbamimidoyl-1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]guanidine;dihydrochloride (PubChem CID 24832561) has the molecular formula C11H19Cl2N9 and a molecular weight of 348.24 g/mol. Its IUPAC name is 1-carbamimidoyl-1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]guanidine;dihydrochloride.
| Compound Name | 1-carbamimidoyl-1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 24832561 |
| Molecular Formula | C11H19Cl2N9 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-carbamimidoyl-1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)N(/C(N)=N/[H])c1ccc(/C(C)=N\N=C(N)N)cc1 |
| InChI | InChI=1S/C11H17N9.2ClH/c1-6(18-19-9(12)13)7-2-4-8(5-3-7)20(10(14)15)11(16)17;;/h2-5H,1H3,(H3,14,15)(H3,16,17)(H4,12,13,19);2*1H/b18-6-;; |
| InChIKey | DHPYVEYECYVIIB-ZTJRJUAFSA-N |
| XLogP | 0.12 |
| TPSA | 179.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|