C11H17N5 — CID 9017548
2-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]guanidine (PubChem CID 9017548) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]guanidine.
| Compound Name | 2-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 9017548 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]guanidine |
| SMILES | C/C(=N/N=C(N)N)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C11H17N5/c1-8(14-15-11(12)13)9-4-6-10(7-5-9)16(2)3/h4-7H,1-3H3,(H4,12,13,15)/b14-8- |
| InChIKey | VBAVUJVITOLCFI-ZSOIEALJSA-N |
| XLogP | 0.75 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|