C12H18N8O — CID 135527034
2-[(E)-1-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-4-hydroxyphenyl]ethylideneamino]guanidine (PubChem CID 135527034) has the molecular formula C12H18N8O and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-[(E)-1-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-4-hydroxyphenyl]ethylideneamino]guanidine.
| Compound Name | 2-[(E)-1-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-4-hydroxyphenyl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 135527034 |
| Molecular Formula | C12H18N8O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[(E)-1-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-4-hydroxyphenyl]ethylideneamino]guanidine |
| SMILES | C/C(=N\N=C(N)N)c1ccc(O)c(/C(C)=N/N=C(N)N)c1 |
| InChI | InChI=1S/C12H18N8O/c1-6(17-19-11(13)14)8-3-4-10(21)9(5-8)7(2)18-20-12(15)16/h3-5,21H,1-2H3,(H4,13,14,19)(H4,15,16,20)/b17-6+,18-7+ |
| InChIKey | HMRGIGRAKYEBQX-PGUOUAKWSA-N |
| XLogP | -0.61 |
| TPSA | 173.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|