C19H23ClN8 — CID 54598572
2-[(E)-1-[7-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-9H-fluoren-2-yl]ethylideneamino]guanidine;hydrochloride (PubChem CID 54598572) has the molecular formula C19H23ClN8 and a molecular weight of 398.90 g/mol. Its IUPAC name is 2-[(E)-1-[7-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-9H-fluoren-2-yl]ethylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[(E)-1-[7-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-9H-fluoren-2-yl]ethylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 54598572 |
| Molecular Formula | C19H23ClN8 |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[(E)-1-[7-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-9H-fluoren-2-yl]ethylideneamino]guanidine;hydrochloride |
| SMILES | C/C(=N\N=C(N)N)c1ccc2c(c1)Cc1cc(/C(C)=N/N=C(N)N)ccc1-2.Cl |
| InChI | InChI=1S/C19H22N8.ClH/c1-10(24-26-18(20)21)12-3-5-16-14(7-12)9-15-8-13(4-6-17(15)16)11(2)25-27-19(22)23;/h3-8H,9H2,1-2H3,(H4,20,21,26)(H4,22,23,27);1H/b24-10+,25-11+; |
| InChIKey | LCEYRHCRTXGILW-WIMOUKPPSA-N |
| XLogP | 1.67 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|