C13H19ClN4 — CID 160531205
2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]guanidine;hydrochloride (PubChem CID 160531205) has the molecular formula C13H19ClN4 and a molecular weight of 266.78 g/mol. Its IUPAC name is 2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 160531205 |
| Molecular Formula | C13H19ClN4 |
| Molecular Weight | 266.78 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]guanidine;hydrochloride |
| SMILES | CC(=NN=C(N)N)c1ccc2c(c1)CCCC2.Cl |
| InChI | InChI=1S/C13H18N4.ClH/c1-9(16-17-13(14)15)11-7-6-10-4-2-3-5-12(10)8-11;/h6-8H,2-5H2,1H3,(H4,14,15,17);1H |
| InChIKey | QVOFTUVREZRRBF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.78 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|