C16H23NOS — CID 175444003
tert-butyl-oxido-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]sulfanium (PubChem CID 175444003) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is tert-butyl-oxido-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]sulfanium.
| Compound Name | tert-butyl-oxido-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]sulfanium |
|---|---|
| PubChem CID | 175444003 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | tert-butyl-oxido-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]sulfanium |
| SMILES | CC(=N[S+]([O-])C(C)(C)C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C16H23NOS/c1-12(17-19(18)16(2,3)4)14-10-9-13-7-5-6-8-15(13)11-14/h9-11H,5-8H2,1-4H3 |
| InChIKey | VQHNYYHYHHDUIJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|