C15H20N2O3S — CID 175220174
tert-butyl-[1-(1-carboxy-2,3-dihydroindol-5-yl)ethylideneamino]-oxidosulfanium (PubChem CID 175220174) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is tert-butyl-[1-(1-carboxy-2,3-dihydroindol-5-yl)ethylideneamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-(1-carboxy-2,3-dihydroindol-5-yl)ethylideneamino]-oxidosulfanium |
|---|---|
| PubChem CID | 175220174 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | tert-butyl-[1-(1-carboxy-2,3-dihydroindol-5-yl)ethylideneamino]-oxidosulfanium |
| SMILES | CC(=N[S+]([O-])C(C)(C)C)c1ccc2c(c1)CCN2C(=O)O |
| InChI | InChI=1S/C15H20N2O3S/c1-10(16-21(20)15(2,3)4)11-5-6-13-12(9-11)7-8-17(13)14(18)19/h5-6,9H,7-8H2,1-4H3,(H,18,19) |
| InChIKey | DQMZHKRTMAUCEH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|