C9H8ClNO2 — CID 68859490
5-chloro-2,3-dihydroindole-1-carboxylic acid (PubChem CID 68859490) has the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. Its IUPAC name is 5-chloro-2,3-dihydroindole-1-carboxylic acid.
| Compound Name | 5-chloro-2,3-dihydroindole-1-carboxylic acid |
|---|---|
| PubChem CID | 68859490 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 5-chloro-2,3-dihydroindole-1-carboxylic acid |
| SMILES | O=C(O)N1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H8ClNO2/c10-7-1-2-8-6(5-7)3-4-11(8)9(12)13/h1-2,5H,3-4H2,(H,12,13) |
| InChIKey | AWNMURUHZNMHCF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |