C17H17ClN2O — CID 69222522
7-chloro-N-phenyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide (PubChem CID 69222522) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 7-chloro-N-phenyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide.
| Compound Name | 7-chloro-N-phenyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
|---|---|
| PubChem CID | 69222522 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 7-chloro-N-phenyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCCCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H17ClN2O/c18-14-9-10-16-13(12-14)6-4-5-11-20(16)17(21)19-15-7-2-1-3-8-15/h1-3,7-10,12H,4-6,11H2,(H,19,21) |
| InChIKey | HUWRVNXVUPESLC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |